* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N6-BENZOYL-3'-DEOXYADENOSINE |
| CAS: | 76902-49-3 |
| English Synonyms: | N6-BENZOYL-3'-DEOXYADENOSINE |
| MDL Number.: | MFCD01630965 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)C(=O)Nc2c3c(ncn2)n(cn3)[C@H]4[C@@H](C[C@H](O4)CO)O |
| InChi: | InChI=1S/C17H17N5O4/c23-7-11-6-12(24)17(26-11)22-9-20-13-14(18-8-19-15(13)22)21-16(25)10-4-2-1-3-5-10/h1-5,8-9,11-12,17,23-24H,6-7H2,(H,18,19,21,25)/t11-,12+,17+/m0/s1 |
| InChiKey: | InChIKey=GNPRDDYSJSKPJF-XWCIJXRUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.