* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzoic acid, 4-bromo-3,5-dimethyl- |
CAS: | 7697-32-7 |
English Synonyms: | BENZOIC ACID, 4-BROMO-3,5-DIMETHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=C(C=C(C(=O)O)C=C1C)C |
InChi: | InChI=1S/C9H9BrO2/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4H,1-2H3,(H,11,12) |
InChiKey: | InChIKey=OKEOADKQDIJJMU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.