* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(3,4-DIAMINOPHENOXY)-7-AZAINDOLE |
CAS: | 769961-36-6 |
English Synonyms: | 4-(3,4-DIAMINOPHENOXY)-7-AZAINDOLE |
MDL Number.: | MFCD11849314 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1Oc2ccnc3c2cc[nH]3)N)N |
InChi: | InChI=1S/C13H12N4O/c14-10-2-1-8(7-11(10)15)18-12-4-6-17-13-9(12)3-5-16-13/h1-7H,14-15H2,(H,16,17) |
InChiKey: | InChIKey=NHEABRBXTYPRPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.