* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-Amino-5,7-dibromobenzothiazole |
CAS: | 771-86-8 |
English Synonyms: | 6-AMINO-5,7-DIBROMOBENZOTHIAZOLE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC1=C(C2=C(N=CS2)C=C1Br)Br |
InChi: | InChI=1S/C7H4Br2N2S/c8-3-1-4-7(12-2-11-4)5(9)6(3)10/h1-2H,10H2 |
InChiKey: | InChIKey=CRUNLBPUXULNKA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.