* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-IODOQUINOXALINE |
CAS: | 77130-31-5 |
English Synonyms: | 5-IODOQUINOXALINE |
MDL Number.: | MFCD12028720 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2c(c(c1)I)nccn2 |
InChi: | InChI=1S/C8H5IN2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-5H |
InChiKey: | InChIKey=TYSZAJGEZDFMID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.