* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,6-DICHLOROBENZO-2',6'-XYLIDIDE |
CAS: | 77331-26-1 |
English Synonyms: | 2,6-DICHLOROBENZO-2',6'-XYLIDIDE |
MDL Number.: | MFCD00028532 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1NC(=O)c2c(cccc2Cl)Cl)C |
InChi: | InChI=1S/C15H13Cl2NO/c1-9-5-3-6-10(2)14(9)18-15(19)13-11(16)7-4-8-12(13)17/h3-8H,1-2H3,(H,18,19) |
InChiKey: | InChIKey=LZPQHPCDGJEJKX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.