* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(1-ADAMANTYL)PROPAN-2-OL |
| CAS: | 775-64-4 |
| English Synonyms: | 2-ADAMANTAN-1-YL-PROPAN-2-OL ; 2-(ADAMANT-1-YL)PROPAN-2-OL ; 2-(1-ADAMANTYL)PROPAN-2-OL |
| MDL Number.: | MFCD00167855 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC(C)([C@@]12C[C@H]3C[C@@H](C1)C[C@H](C3)C2)O |
| InChi: | InChI=1S/C13H22O/c1-12(2,14)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11,14H,3-8H2,1-2H3/t9-,10+,11-,13- |
| InChiKey: | InChIKey=WBKAUEBLTWRERU-DNSLJTBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.