* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-CHLORO-2,2,3,3,4-PENTAFLUOROPENT-4-ENOIC ACID |
CAS: | 77569-70-1 |
English Synonyms: | 5-CHLORO-2,2,3,3,4-PENTAFLUOROPENT-4-ENOIC ACID |
MDL Number.: | MFCD04972739 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C(=C(\C(C(C(=O)O)(F)F)(F)F)/F)\Cl |
InChi: | InChI=1S/C5H2ClF5O2/c6-1-2(7)4(8,9)5(10,11)3(12)13/h1H,(H,12,13)/b2-1+ |
InChiKey: | InChIKey=VVMMFOBAGFALDI-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.