* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ACETYLENE DICARBOXYLIC ACID, [2,3-14C] |
CAS: | 77585-15-0 |
English Synonyms: | ACETYLENE DICARBOXYLIC ACID, [2,3-14C] |
MDL Number.: | MFCD00133022 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | [14C](#[14C]C(=O)O)C(=O)O |
InChi: | InChI=1S/C4H2O4/c5-3(6)1-2-4(7)8/h(H,5,6)(H,7,8)/i1+2,2+2 |
InChiKey: | InChIKey=YTIVTFGABIZHHX-XPULMUKRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.