* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AC-TYR-PHE-OH |
CAS: | 7762-61-0 |
English Synonyms: | AC-TYR-PHE-OH |
MDL Number.: | MFCD00136641 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)O |
InChi: | InChI=1S/C20H22N2O5/c1-13(23)21-17(11-15-7-9-16(24)10-8-15)19(25)22-18(20(26)27)12-14-5-3-2-4-6-14/h2-10,17-18,24H,11-12H2,1H3,(H,21,23)(H,22,25)(H,26,27)/t17-,18-/m0/s1 |
InChiKey: | InChIKey=LMNISZPMTXRXKN-ROUUACIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.