* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Q199 2-(8-CARBOXYOCTYL)-3-HYDROXY-1,4-NAPHTHOQUINONE |
| CAS: | 77634-56-1 |
| English Synonyms: | Q199 2-(8-CARBOXYOCTYL)-3-HYDROXY-1,4-NAPHTHOQUINONE |
| MDL Number.: | MFCD00019626 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)C(=O)C(=C(C2=O)O)CCCCCCCCC(=O)O |
| InChi: | InChI=1S/C19H22O5/c20-16(21)12-6-4-2-1-3-5-11-15-17(22)13-9-7-8-10-14(13)18(23)19(15)24/h7-10,24H,1-6,11-12H2,(H,20,21) |
| InChiKey: | InChIKey=KPVQUBVSFWCUSE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.