* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4-Oxazolidinedione, 3-(4-piperidinyl)- |
CAS: | 777014-23-0 |
English Synonyms: | 2,4-OXAZOLIDINEDIONE, 3-(4-PIPERIDINYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1CCC(CC1)N1C(OCC1=O)=O |
InChi: | InChI=1S/C8H12N2O3/c11-7-5-13-8(12)10(7)6-1-3-9-4-2-6/h6,9H,1-5H2 |
InChiKey: | InChIKey=PAAUPTFPLUXGTJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.