* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,2,7,8-TETRAMETHYL-2H-1-BENZOPYRAN-6-AMINE |
| CAS: | 777016-50-9 |
| English Synonyms: | 2,2,7,8-TETRAMETHYL-2H-1-BENZOPYRAN-6-AMINE ; 2H-1-BENZOPYRAN-6-AMINE, 2,2,7,8-TETRAMETHYL- |
| MDL Number.: | MFCD18814345 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1c(c2c(cc1N)C=CC(O2)(C)C)C |
| InChi: | InChI=1S/C13H17NO/c1-8-9(2)12-10(7-11(8)14)5-6-13(3,4)15-12/h5-7H,14H2,1-4H3 |
| InChiKey: | InChIKey=DAZLLXJENUOYDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.