* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VUFB-6792 |
| CAS: | 77778-92-8 |
| English Synonyms: | VUFB-6792 |
| MDL Number.: | MFCD01673614 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CN(C)CCCNC(=O)Cn1c2ccccc2c(=O)c3c1cccc3.Cl |
| InChi: | InChI=1S/C20H23N3O2.ClH/c1-22(2)13-7-12-21-19(24)14-23-17-10-5-3-8-15(17)20(25)16-9-4-6-11-18(16)23;/h3-6,8-11H,7,12-14H2,1-2H3,(H,21,24);1H |
| InChiKey: | InChIKey=OKUUQISPEAWVGD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.