* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3'-AMINO-BIPHENYL-3-OL |
CAS: | 779341-19-4 |
English Synonyms: | 3-(3-AMINOPHENYL)PHENOL ; 3'-AMINO-BIPHENYL-3-OL |
MDL Number.: | MFCD04117380 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(cc(c1)N)c2cccc(c2)O |
InChi: | InChI=1S/C12H11NO/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8,14H,13H2 |
InChiKey: | InChIKey=BFTXLAFWQOHRMU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.