* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(4-AMINOPHENYL)PHENOL |
CAS: | 779341-20-7 |
English Synonyms: | 3-(4-AMINOPHENYL)PHENOL ; 4'-AMINOBIPHENYL-3-OL |
MDL Number.: | MFCD04117379 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(cc(c1)O)c2ccc(cc2)N |
InChi: | InChI=1S/C12H11NO/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h1-8,14H,13H2 |
InChiKey: | InChIKey=QYWZHZKOIPJCKM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.