* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,5-DIETHYL-2-PHENYL-1,3-DIOXANE |
CAS: | 780-85-8 |
English Synonyms: | 5,5-DIETHYL-2-PHENYL-1,3-DIOXANE |
MDL Number.: | MFCD00031006 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC1(COC(OC1)c2ccccc2)CC |
InChi: | InChI=1S/C14H20O2/c1-3-14(4-2)10-15-13(16-11-14)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
InChiKey: | InChIKey=YGWYPRIDROYZLZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.