* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PRO-LEU-GLY-OH |
| CAS: | 7801-38-9 |
| English Synonyms: | Z-PRO-LEU-GLY-OH |
| MDL Number.: | MFCD00057239 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | CC(C)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C21H29N3O6/c1-14(2)11-16(19(27)22-12-18(25)26)23-20(28)17-9-6-10-24(17)21(29)30-13-15-7-4-3-5-8-15/h3-5,7-8,14,16-17H,6,9-13H2,1-2H3,(H,22,27)(H,23,28)(H,25,26)/t16-,17-/m0/s1 |
| InChiKey: | InChIKey=WOTUJALMKRAEDD-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.