* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-AMINO-3-METHYLADAMANTANE |
| CAS: | 78056-28-7 |
| English Synonyms: | 1-AMINO-3-METHYLADAMANTANE |
| MDL Number.: | MFCD01838794 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C[C@]12C[C@@H]3C[C@H](C1)C[C@@](C3)(C2)N |
| InChi: | InChI=1S/C11H19N/c1-10-3-8-2-9(4-10)6-11(12,5-8)7-10/h8-9H,2-7,12H2,1H3/t8-,9+,10-,11- |
| InChiKey: | InChIKey=MWMFMCTUGUZSJJ-BIBSGERRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.