* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VANILOL |
| CAS: | 78100-57-9 |
| English Synonyms: | VANILOL |
| MDL Number.: | MFCD01661657 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)NCC(COc1ccc(cc1OC)C(=O)OC)O |
| InChi: | InChI=1S/C15H23NO5/c1-10(2)16-8-12(17)9-21-13-6-5-11(15(18)20-4)7-14(13)19-3/h5-7,10,12,16-17H,8-9H2,1-4H3 |
| InChiKey: | InChIKey=MKDCAESMSRQHIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.