* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2S)-2-[(2R)-BUT-3-EN-2-YL]CYCLOHEXAN-1-ONE |
CAS: | 782479-85-0 |
English Synonyms: | CYCLOHEXANONE, 2-[(1R)-1-METHYL-2-PROPENYL]-, (2S)- ; (2S)-2-[(2R)-BUT-3-EN-2-YL]CYCLOHEXAN-1-ONE |
MDL Number.: | MFCD18831314 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[C@H](C=C)[C@@H]1CCCCC1=O |
InChi: | InChI=1S/C10H16O/c1-3-8(2)9-6-4-5-7-10(9)11/h3,8-9H,1,4-7H2,2H3/t8-,9+/m1/s1 |
InChiKey: | InChIKey=LDXRWNQVMIYPLJ-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.