* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUCROMARONE |
| CAS: | 78371-66-1 |
| English Synonyms: | BUCROMARONE |
| MDL Number.: | MFCD00864709 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCCCN(CCCC)CCCOc1c(cc(cc1C)C(=O)c2cc(=O)c3ccccc3o2)C |
| InChi: | InChI=1S/C29H37NO4/c1-5-7-14-30(15-8-6-2)16-11-17-33-29-21(3)18-23(19-22(29)4)28(32)27-20-25(31)24-12-9-10-13-26(24)34-27/h9-10,12-13,18-20H,5-8,11,14-17H2,1-4H3 |
| InChiKey: | InChIKey=DYGLNTZLBQBOPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.