* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDAN-2,5-DIAMINE |
| CAS: | 784106-57-6 |
| English Synonyms: | 2,5-DIAMINOINDAN ; INDAN-2,5-DIAMINE ; 2,3-DIHYDRO-1H-INDENE-2,5-DIAMINE |
| MDL Number.: | MFCD04038658 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1N)CC(C2)N |
| InChi: | InChI=1S/C9H12N2/c10-8-2-1-6-3-9(11)5-7(6)4-8/h1-2,4,9H,3,5,10-11H2 |
| InChiKey: | InChIKey=FZOKDSSCQAFGDX-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.