* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 19-HYDROXYBACCATIN III |
CAS: | 78432-78-7 |
English Synonyms: | 19-HYDROXYBACCATIN III |
MDL Number.: | MFCD17214887 |
H bond acceptor: | 12 |
H bond donor: | 4 |
Smile: | CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1O)O)OC(=O)c5ccccc5)(CO4)OC(=O)C)O)CO)OC(=O)C |
InChi: | InChI=1S/C31H38O12/c1-15-19(35)12-31(39)26(42-27(38)18-9-7-6-8-10-18)24-29(13-32,20(36)11-21-30(24,14-40-21)43-17(3)34)25(37)23(41-16(2)33)22(15)28(31,4)5/h6-10,19-21,23-24,26,32,35-36,39H,11-14H2,1-5H3/t19-,20-,21+,23+,24-,26-,29+,30-,31+/m0/s1 |
InChiKey: | InChIKey=SYDMVWLQJZBPIU-VHLOTGQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.