* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzeneacetamide, α-amino-4-fluoro-, (αS)- |
CAS: | 785041-04-5 |
English Synonyms: | BENZENEACETAMIDE, Α-AMINO-4-FLUORO-, (ΑS)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N[C@H](C(=O)N)C1=CC=C(C=C1)F |
InChi: | InChI=1S/C8H9FN2O/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H2,11,12)/t7-/m0/s1 |
InChiKey: | InChIKey=CMFSFITWLXHVOP-ZETCQYMHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.