* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | PIQUINDONE |
CAS: | 78541-97-6 |
English Synonyms: | PIQUINDONE |
MDL Number.: | MFCD00866653 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1c([nH]c2c1C(=O)[C@@H]3CN(CC[C@H]3C2)C)C |
InChi: | InChI=1S/C15H22N2O/c1-4-11-9(2)16-13-7-10-5-6-17(3)8-12(10)15(18)14(11)13/h10,12,16H,4-8H2,1-3H3/t10-,12+/m0/s1 |
InChiKey: | InChIKey=PVZMYDPRVUCJKV-CMPLNLGQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.