* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BICYCLO[4.2.0]OCTA-1,3,5-TRIENE-7-CARBALDEHYDE |
CAS: | 78926-35-9 |
English Synonyms: | BICYCLO[4.2.0]OCTA-1,3,5-TRIENE-7-CARBALDEHYDE |
MDL Number.: | MFCD11100028 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)CC2C=O |
InChi: | InChI=1S/C9H8O/c10-6-8-5-7-3-1-2-4-9(7)8/h1-4,6,8H,5H2 |
InChiKey: | InChIKey=CAGLJCIYRHLVFP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.