* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-CHLOROPHENYL)-3-(2,6-XYLYL)UREA |
CAS: | 78971-65-0 |
English Synonyms: | 1-(3-CHLOROPHENYL)-3-(2,6-XYLYL)UREA |
MDL Number.: | MFCD00028636 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1cccc(c1NC(=O)Nc2cccc(c2)Cl)C |
InChi: | InChI=1S/C15H15ClN2O/c1-10-5-3-6-11(2)14(10)18-15(19)17-13-8-4-7-12(16)9-13/h3-9H,1-2H3,(H2,17,18,19) |
InChiKey: | InChIKey=JREMWQIUPFESRR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.