* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3S)-3-(1H-IMIDAZOL-1-YLMETHYL)-PIPERIDINE |
CAS: | 790196-15-5 |
English Synonyms: | (3S)-3-(1H-IMIDAZOL-1-YLMETHYL)-PIPERIDINE |
MDL Number.: | MFCD11849616 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cn(cn1)C[C@H]2CCCNC2 |
InChi: | InChI=1S/C9H15N3/c1-2-9(6-10-3-1)7-12-5-4-11-8-12/h4-5,8-10H,1-3,6-7H2/t9-/m0/s1 |
InChiKey: | InChIKey=KFQCTIRXHQSXEZ-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.