* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-PHENYL-PYRAZOLO[1,5-A]PYRIMIDIN-5-OL |
CAS: | 79039-17-1 |
English Synonyms: | 2-PHENYL-PYRAZOLO[1,5-A]PYRIMIDIN-5-OL |
MDL Number.: | MFCD11044154 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2cc3nc(ccn3n2)O |
InChi: | InChI=1S/C12H9N3O/c16-12-6-7-15-11(13-12)8-10(14-15)9-4-2-1-3-5-9/h1-8H,(H,13,16) |
InChiKey: | InChIKey=WUBLHSVMWNLLAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.