* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BENZYL-2,6-DICHLORO-9H-PURINE |
CAS: | 79064-26-9 |
English Synonyms: | 9-BENZYL-2,6-DICHLORO-9H-PURINE |
MDL Number.: | MFCD11047303 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)Cn2cnc3c2nc(nc3Cl)Cl |
InChi: | InChI=1S/C12H8Cl2N4/c13-10-9-11(17-12(14)16-10)18(7-15-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2 |
InChiKey: | InChIKey=CUYCHULDTCBWLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.