* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOQUINOLINE, 1,2,3,4-TETRAHYDRO-1,3-DIMETHYL-7-NITRO-, (1R,3R)- |
CAS: | 791048-46-9 |
English Synonyms: | ISOQUINOLINE, 1,2,3,4-TETRAHYDRO-1,3-DIMETHYL-7-NITRO-, (1R,3R)- |
MDL Number.: | MFCD18832657 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C[C@@H]1Cc2ccc(cc2[C@H](N1)C)[N+](=O)[O-] |
InChi: | InChI=1S/C11H14N2O2/c1-7-5-9-3-4-10(13(14)15)6-11(9)8(2)12-7/h3-4,6-8,12H,5H2,1-2H3/t7-,8-/m1/s1 |
InChiKey: | InChIKey=IAHYHYRUXIBBJR-HTQZYQBOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.