* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzenepropanoic acid, α-azido-, (αS)- |
CAS: | 79410-35-8 |
English Synonyms: | BENZENEPROPANOIC ACID, Α-AZIDO-, (ΑS)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])[C@H](C(=O)O)CC1=CC=CC=C1 |
InChi: | InChI=1S/C9H9N3O2/c10-12-11-8(9(13)14)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14)/t8-/m0/s1 |
InChiKey: | InChIKey=DIFYSVZHVRAXAV-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.