* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DIHYDRO-3-METHYL-PYRROLO[1,2-D][1,2,4]TRIAZINE-1,4-DIONE |
| CAS: | 79442-88-9 |
| English Synonyms: | 2,3-DIHYDRO-3-METHYL-PYRROLO[1,2-D][1,2,4]TRIAZINE-1,4-DIONE |
| MDL Number.: | MFCD13178447 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cn1c(=O)n2cccc2c(=O)[nH]1 |
| InChi: | InChI=1S/C7H7N3O2/c1-9-7(12)10-4-2-3-5(10)6(11)8-9/h2-4H,1H3,(H,8,11) |
| InChiKey: | InChIKey=ZJQJFTISLIDVQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.