* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS-TRP-OH |
| CAS: | 79479-33-7 |
| English Synonyms: | Z-HIS-TRP-OH ; Z-L-HISTIDYL-L-TRYPTOPHAN |
| MDL Number.: | MFCD00191108 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](Cc3c[nH]c4c3cccc4)C(=O)O |
| InChi: | InChI=1S/C25H25N5O5/c31-23(29-22(24(32)33)10-17-12-27-20-9-5-4-8-19(17)20)21(11-18-13-26-15-28-18)30-25(34)35-14-16-6-2-1-3-7-16/h1-9,12-13,15,21-22,27H,10-11,14H2,(H,26,28)(H,29,31)(H,30,34)(H,32,33)/t21-,22-/m0/s1 |
| InChiKey: | InChIKey=JINLNSVUUQVSNM-VXKWHMMOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.