* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-METHYL-2,4-DIPHENYL-1,2-DIHYDRO-3H-PYRAZOL-3-ONE |
CAS: | 79481-69-9 |
English Synonyms: | 5-METHYL-2,4-DIPHENYL-1,2-DIHYDRO-3H-PYRAZOL-3-ONE |
MDL Number.: | MFCD00140645 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1c(c(=O)n([nH]1)c2ccccc2)c3ccccc3 |
InChi: | InChI=1S/C16H14N2O/c1-12-15(13-8-4-2-5-9-13)16(19)18(17-12)14-10-6-3-7-11-14/h2-11,17H,1H3 |
InChiKey: | InChIKey=FXFVSEKKXOPNRA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.