* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(2,3-dichlorophenyl)-5,8-diazaspiro[4.5]decan-5-ium bromide |
CAS: | 795313-24-5 |
English Synonyms: | 8-(2,3-DICHLOROPHENYL)-5,8-DIAZASPIRO[4.5]DECAN-5-IUM BROMIDE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [Br-].ClC1=C(C=CC=C1Cl)N1CC[N+]2(CCCC2)CC1 |
InChi: | InChI=1S/C14H19Cl2N2.BrH/c15-12-4-3-5-13(14(12)16)17-6-10-18(11-7-17)8-1-2-9-18;/h3-5H,1-2,6-11H2;1H/q+1;/p-1 |
InChiKey: | InChIKey=SEDIOOIGAOGDMF-UHFFFAOYSA-M |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.