* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Propanoic acid, 2-azido- |
CAS: | 79583-94-1 |
English Synonyms: | PROPANOIC ACID, 2-AZIDO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])C(C(=O)O)C |
InChi: | InChI=1S/C3H5N3O2/c1-2(3(7)8)5-6-4/h2H,1H3,(H,7,8) |
InChiKey: | InChIKey=XVNBLPHVIQXLMS-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.