* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2-Azidoethoxy)acetic acid |
CAS: | 79598-48-4 |
English Synonyms: | 2-(2-AZIDOETHOXY)ACETIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCOCC(=O)O |
InChi: | InChI=1S/C4H7N3O3/c5-7-6-1-2-10-3-4(8)9/h1-3H2,(H,8,9) |
InChiKey: | InChIKey=USTXYASKHZDVMV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.