* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AMINO-5-(PYRIDIN-3-YL)PYRIDIN-2-OL |
| CAS: | 79611-44-2 |
| English Synonyms: | 5-AMINO-[3,3'-BIPYRIDIN]-6(1H)-ONE ; 3-AMINO-5-(PYRIDIN-3-YL)PYRIDIN-2-OL |
| MDL Number.: | MFCD15476763 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(cnc1)c2cc(c(nc2)O)N |
| InChi: | InChI=1S/C10H9N3O/c11-9-4-8(6-13-10(9)14)7-2-1-3-12-5-7/h1-6H,11H2,(H,13,14) |
| InChiKey: | InChIKey=LHWAVCJDVQZDFB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.