Molecular Structure:
CAS No.:
79695-13-9
Product Name.:
CCD No.:CCD00043585
Formula:C25 H38 N2 O6 S
MolWeight:494.649
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | LEUKOTRIENE D5 |
| CAS： | 79695-13-9 |
| English Synonyms： | LEUKOTRIENE D5 ; LTD5 |
| MDL Number.： | MFCD00065879 |
| H bond acceptor： | 8 |
| H bond donor： | 5 |
| Smile： | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)SC[C@H](C(=O)NCC(=O)O)N |
| InChi： | InChI=1S/C25H38N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h3-4,6-7,9-13,16,20-22,28H,2,5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b4-3-,7-6-,10-9-,12-11+,16-13+/t20-,21+,22-/m1/s1 |
| InChiKey： | InChIKey=RWLDHKGRPLNPBN-IYDTVIHVSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
