* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CHLORO-3-ETHYL-1,3-DIHYDRO-2H-INDOL-2-ONE |
| CAS: | 797051-96-8 |
| English Synonyms: | 5-CHLORO-3-ETHYL-1,3-DIHYDRO-2H-INDOL-2-ONE ; 5-CHLORO-3-ETHYL-2,3-DIHYDRO-1H-INDOL-2-ONE |
| MDL Number.: | MFCD16304229 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC1c2cc(ccc2NC1=O)Cl |
| InChi: | InChI=1S/C10H10ClNO/c1-2-7-8-5-6(11)3-4-9(8)12-10(7)13/h3-5,7H,2H2,1H3,(H,12,13) |
| InChiKey: | InChIKey=FRCQDVQBKBEJKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.