* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BARUCAINIDE |
| CAS: | 79784-22-8 |
| English Synonyms: | BARUCAINIDE |
| MDL Number.: | MFCD00864750 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1c(c2c(c(n1)Cc3ccccc3)COC2)OCCCCNC(C)C |
| InChi: | InChI=1S/C22H30N2O2/c1-16(2)23-11-7-8-12-26-22-17(3)24-21(19-14-25-15-20(19)22)13-18-9-5-4-6-10-18/h4-6,9-10,16,23H,7-8,11-15H2,1-3H3 |
| InChiKey: | InChIKey=KXSKBNFNSAMNEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.