* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TRANS-1,3-DITHIOLANE 1,3-DIOXIDE |
CAS: | 79888-76-9 |
English Synonyms: | TRANS-1,3-DITHIOLANE 1,3-DIOXIDE |
MDL Number.: | MFCD17019276 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1C[S@](=O)C[S@]1=O |
InChi: | InChI=1S/C3H6O2S2/c4-6-1-2-7(5)3-6/h1-3H2/t6-,7-/m0/s1 |
InChiKey: | InChIKey=PFTBJUFGODPOCY-BQBZGAKWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.