* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Phenol, 3-(3-piperidinyl)- |
CAS: | 79987-84-1 |
English Synonyms: | PHENOL, 3-(3-PIPERIDINYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1CC(CCC1)C=1C=C(C=CC1)O |
InChi: | InChI=1S/C11H15NO/c13-11-5-1-3-9(7-11)10-4-2-6-12-8-10/h1,3,5,7,10,12-13H,2,4,6,8H2 |
InChiKey: | InChIKey=HYUOAVGLJXTEGX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.