* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZINC GALLATE |
CAS: | 8006-22-2 |
English Synonyms: | ZINC GALLATE |
MDL Number.: | MFCD00045845 |
H bond acceptor: | 10 |
H bond donor: | 6 |
Smile: | c1c(cc(c(c1O)O)O)C(=O)O[Zn]OC(=O)c2cc(c(c(c2)O)O)O |
InChi: | InChI=1S/2C7H6O5.Zn/c2*8-4-1-3(7(11)12)2-5(9)6(4)10;/h2*1-2,8-10H,(H,11,12);/q;;+2/p-2 |
InChiKey: | InChIKey=RKSNLJBWLIWZID-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.