* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(4-FLUOROPHENYL)PROP-2-YN-1-OL |
CAS: | 80151-28-6 |
English Synonyms: | 3-(4-FLUOROPHENYL)PROP-2-YN-1-OL ; 3-(4-FLUOROPHENYL)-2-PROPYN-1-OL ; 2-PROPYN-1-OL, 3-(4-FLUOROPHENYL)- |
MDL Number.: | MFCD04039232 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C#CCO)F |
InChi: | InChI=1S/C9H7FO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,7H2 |
InChiKey: | InChIKey=ZROXSIPANMVWHB-UHFFFAOYSA-N |
Property |
|
Boiling Point: | MP: 32-33 DEG C |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.