* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMK 334 |
CAS: | 80171-75-1 |
English Synonyms: | AMK 334 |
MDL Number.: | MFCD01739680 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCOCc1cccc(c1)NC(=O)OCCN2CCCCC2.Cl |
InChi: | InChI=1S/C18H28N2O3.ClH/c1-2-12-22-15-16-7-6-8-17(14-16)19-18(21)23-13-11-20-9-4-3-5-10-20;/h6-8,14H,2-5,9-13,15H2,1H3,(H,19,21);1H |
InChiKey: | InChIKey=OLBLOJIWFIPOPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.