* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINPIROLE |
| CAS: | 85760-74-3 ;80373-22-4 |
| English Synonyms: | (-)-QUINPIROLE ; QUINPIROLE |
| MDL Number.: | MFCD00865930 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCN1CCC[C@H]2[C@H]1Cc3cn[nH]c3C2 |
| InChi: | InChI=1S/C13H21N3/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12/h9-10,13H,2-8H2,1H3,(H,14,15)/t10-,13-/m1/s1 |
| InChiKey: | InChIKey=FTSUPYGMFAPCFZ-ZWNOBZJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.