Molecular Structure:
CAS No.:
80445-66-5
Product Name.:
CCD No.:CCD00043583
Formula:C20 H30 O4
MolWeight:334.453
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(9)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | LEUKOTRIENE B5 |
| CAS： | 80445-66-5 |
| English Synonyms： | [5S,12R]-DIHYDROXY-[6Z,8E,10E,14Z,17Z]-EICOSAPENTAENOIC ACID ; LEUKOTRIENE B5 ; LTB5 |
| MDL Number.： | MFCD00065877 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | CC/C=C\C/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CCCC(=O)O)O)O |
| InChi： | InChI=1S/C20H30O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h3-4,6-11,14-15,18-19,21-22H,2,5,12-13,16-17H2,1H3,(H,23,24)/b4-3-,8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1 |
| InChiKey： | InChIKey=BISQPGCQOHLHQK-HDNPQISLSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
